C18H22N4O5S — CID 68965618
4-[[5-[4-(methylsulfamoyl)phenyl]pyrazin-2-yl]oxymethyl]piperidine-1-carboxylic acid (PubChem CID 68965618) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-[[5-[4-(methylsulfamoyl)phenyl]pyrazin-2-yl]oxymethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[5-[4-(methylsulfamoyl)phenyl]pyrazin-2-yl]oxymethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68965618 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-[[5-[4-(methylsulfamoyl)phenyl]pyrazin-2-yl]oxymethyl]piperidine-1-carboxylic acid |
| SMILES | CNS(=O)(=O)c1ccc(-c2cnc(OCC3CCN(C(=O)O)CC3)cn2)cc1 |
| InChI | InChI=1S/C18H22N4O5S/c1-19-28(25,26)15-4-2-14(3-5-15)16-10-21-17(11-20-16)27-12-13-6-8-22(9-7-13)18(23)24/h2-5,10-11,13,19H,6-9,12H2,1H3,(H,23,24) |
| InChIKey | MIOAPDWEFHGTOE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |