C26H34N4O4 — CID 68965819
(E)-3-[6-[[(3R)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 68965819) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is (E)-3-[6-[[(3R)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[[(3R)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68965819 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (E)-3-[6-[[(3R)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CN(C)c1ccc(CN2CC[C@@H](N(C(=O)OC(C)(C)C)c3ccc(/C=C/C(=O)O)cn3)C2)cc1 |
| InChI | InChI=1S/C26H34N4O4/c1-26(2,3)34-25(33)30(23-12-8-19(16-27-23)9-13-24(31)32)22-14-15-29(18-22)17-20-6-10-21(11-7-20)28(4)5/h6-13,16,22H,14-15,17-18H2,1-5H3,(H,31,32)/b13-9+/t22-/m1/s1 |
| InChIKey | PUIPYCJECXGUOE-SNMYMPMCSA-N |
| XLogP | 4.26 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|