C24H27N8O+ — CID 68966132
6-N-[1-[5-methyl-3-(2-methylphenyl)-1-oxo-2,4-dihydroquinazolin-1-ium-2-yl]propyl]-7H-purine-2,6-diamine (PubChem CID 68966132) has the molecular formula C24H27N8O+ and a molecular weight of 443.54 g/mol. Its IUPAC name is 6-N-[1-[5-methyl-3-(2-methylphenyl)-1-oxo-2,4-dihydroquinazolin-1-ium-2-yl]propyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[1-[5-methyl-3-(2-methylphenyl)-1-oxo-2,4-dihydroquinazolin-1-ium-2-yl]propyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 68966132 |
| Molecular Formula | C24H27N8O+ |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 6-N-[1-[5-methyl-3-(2-methylphenyl)-1-oxo-2,4-dihydroquinazolin-1-ium-2-yl]propyl]-7H-purine-2,6-diamine |
| SMILES | CCC(Nc1nc(N)nc2nc[nH]c12)C1N(c2ccccc2C)Cc2c(C)cccc2[N+]1=O |
| InChI | InChI=1S/C24H27N8O/c1-4-17(28-22-20-21(27-13-26-20)29-24(25)30-22)23-31(18-10-6-5-8-15(18)3)12-16-14(2)9-7-11-19(16)32(23)33/h5-11,13,17,23H,4,12H2,1-3H3,(H4,25,26,27,28,29,30)/q+1 |
| InChIKey | DJILXAMWGXAISF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|