About 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid
1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid (PubChem CID 68966719) has the molecular formula C15H22N4O3S
and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 68966719 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1CN(c2nccs2)CCN1C(=O)CN1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C15H22N4O3S/c1-11-8-18(15-16-3-7-23-15)5-6-19(11)13(20)10-17-4-2-12(9-17)14(21)22/h3,7,11-12H,2,4-6,8-10H2,1H3,(H,21,22) |
| InChIKey | UYBUFYYRLZSVOR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid (CID 68966719) is 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid is CC1CN(c2nccs2)CCN1C(=O)CN1CCC(C(=O)O)C1.
What is the InChIKey of 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid?
The InChIKey is UYBUFYYRLZSVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O3S/c1-11-8-18(15-16-3-7-23-15)5-6-19(11)13(20)10-17-4-2-12(9-17)14(21)22/h3,7,11-12H,2,4-6,8-10H2,1H3,(H,21,22).
What are the key properties of 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid?
1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid has a molecular weight of 338.43 g/mol, XLogP of 0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 68966719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).