C18H31NO — CID 68966775
(1S,8S,8aS)-6-(diethylamino)-8-methyl-8a-prop-2-enyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol (PubChem CID 68966775) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (1S,8S,8aS)-6-(diethylamino)-8-methyl-8a-prop-2-enyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol.
| Compound Name | (1S,8S,8aS)-6-(diethylamino)-8-methyl-8a-prop-2-enyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol |
|---|---|
| PubChem CID | 68966775 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (1S,8S,8aS)-6-(diethylamino)-8-methyl-8a-prop-2-enyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-1-ol |
| SMILES | C=CC[C@@]12C(=CC(N(CC)CC)C[C@@H]1C)CCC[C@@H]2O |
| InChI | InChI=1S/C18H31NO/c1-5-11-18-14(4)12-16(19(6-2)7-3)13-15(18)9-8-10-17(18)20/h5,13-14,16-17,20H,1,6-12H2,2-4H3/t14-,16?,17-,18-/m0/s1 |
| InChIKey | PMMZAMZUEHUSTJ-NDUHQTEVSA-N |
| XLogP | 3.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|