C21H26O4 — CID 68966800
(4aS,5S)-3-[(3,4-dimethoxyphenyl)methylidene]-5-hydroxy-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68966800) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (4aS,5S)-3-[(3,4-dimethoxyphenyl)methylidene]-5-hydroxy-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (4aS,5S)-3-[(3,4-dimethoxyphenyl)methylidene]-5-hydroxy-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68966800 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (4aS,5S)-3-[(3,4-dimethoxyphenyl)methylidene]-5-hydroxy-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | COc1ccc(C=C2C[C@@]3(C)C(=C(C)C2=O)CCC[C@@H]3O)cc1OC |
| InChI | InChI=1S/C21H26O4/c1-13-16-6-5-7-19(22)21(16,2)12-15(20(13)23)10-14-8-9-17(24-3)18(11-14)25-4/h8-11,19,22H,5-7,12H2,1-4H3/t19-,21-/m0/s1 |
| InChIKey | AEFVYALZDIUNAZ-FPOVZHCZSA-N |
| XLogP | 3.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|