C24H32O2 — CID 68966813
(3E,4R,4aS,5S)-5-hydroxy-4-methyl-4a-prop-2-enyl-3-[[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68966813) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (3E,4R,4aS,5S)-5-hydroxy-4-methyl-4a-prop-2-enyl-3-[[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4R,4aS,5S)-5-hydroxy-4-methyl-4a-prop-2-enyl-3-[[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68966813 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (3E,4R,4aS,5S)-5-hydroxy-4-methyl-4a-prop-2-enyl-3-[[(4R)-4-prop-1-en-2-ylcyclohexen-1-yl]methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | C=CC[C@@]12C(=CC(=O)/C(=C/C3=CC[C@H](C(=C)C)CC3)[C@@H]1C)CCC[C@@H]2O |
| InChI | InChI=1S/C24H32O2/c1-5-13-24-17(4)21(14-18-9-11-19(12-10-18)16(2)3)22(25)15-20(24)7-6-8-23(24)26/h5,9,14-15,17,19,23,26H,1-2,6-8,10-13H2,3-4H3/b21-14+/t17-,19-,23-,24-/m0/s1 |
| InChIKey | JYLFNQRBSUTGQI-XIHOINCCSA-N |
| XLogP | 5.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|