About 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine
5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine (PubChem CID 68966932) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine.
Molecular Properties
| Compound Name | 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine |
| PubChem CID | 68966932 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine |
| SMILES | Nc1ccc2c(c1)CCc1cc(N)ccc1O2 |
| InChI | InChI=1S/C14H14N2O/c15-11-3-5-13-9(7-11)1-2-10-8-12(16)4-6-14(10)17-13/h3-8H,1-2,15-16H2 |
| InChIKey | WUSMVJBIMKLISO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine?
The IUPAC name of 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine (CID 68966932) is 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine.
What is the SMILES notation for 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine?
The canonical SMILES for 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine is Nc1ccc2c(c1)CCc1cc(N)ccc1O2.
What is the InChIKey of 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine?
The InChIKey is WUSMVJBIMKLISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c15-11-3-5-13-9(7-11)1-2-10-8-12(16)4-6-14(10)17-13/h3-8H,1-2,15-16H2.
What are the key properties of 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine?
5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine has a molecular weight of 226.28 g/mol, XLogP of 2.74, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydrobenzo[b][1]benzoxepine-3,8-diamine is sourced from PubChem (CID 68966932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).