C15H18ClNO3 — CID 68967042
2-chloro-4-[(8-methyl-8-azabicyclo[3.2.1]octan-1-yl)oxy]benzoic acid (PubChem CID 68967042) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-chloro-4-[(8-methyl-8-azabicyclo[3.2.1]octan-1-yl)oxy]benzoic acid.
| Compound Name | 2-chloro-4-[(8-methyl-8-azabicyclo[3.2.1]octan-1-yl)oxy]benzoic acid |
|---|---|
| PubChem CID | 68967042 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-chloro-4-[(8-methyl-8-azabicyclo[3.2.1]octan-1-yl)oxy]benzoic acid |
| SMILES | CN1C2CCCC1(Oc1ccc(C(=O)O)c(Cl)c1)CC2 |
| InChI | InChI=1S/C15H18ClNO3/c1-17-10-3-2-7-15(17,8-6-10)20-11-4-5-12(14(18)19)13(16)9-11/h4-5,9-10H,2-3,6-8H2,1H3,(H,18,19) |
| InChIKey | NBLYZKHPICGWDB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |