C19H22O3 — CID 68967365
(3E,4R,4aS,5S)-3-(furan-3-ylmethylidene)-5-hydroxy-4-methyl-4a-prop-2-enyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68967365) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3E,4R,4aS,5S)-3-(furan-3-ylmethylidene)-5-hydroxy-4-methyl-4a-prop-2-enyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4R,4aS,5S)-3-(furan-3-ylmethylidene)-5-hydroxy-4-methyl-4a-prop-2-enyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68967365 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3E,4R,4aS,5S)-3-(furan-3-ylmethylidene)-5-hydroxy-4-methyl-4a-prop-2-enyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | C=CC[C@@]12C(=CC(=O)/C(=C/c3ccoc3)[C@@H]1C)CCC[C@@H]2O |
| InChI | InChI=1S/C19H22O3/c1-3-8-19-13(2)16(10-14-7-9-22-12-14)17(20)11-15(19)5-4-6-18(19)21/h3,7,9-13,18,21H,1,4-6,8H2,2H3/b16-10+/t13-,18-,19-/m0/s1 |
| InChIKey | NGFGFKZCWJMYQS-XADHWOJNSA-N |
| XLogP | 3.92 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|