C15H22O3 — CID 68968036
5-(1,3-dioxolan-2-yl)-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 68968036) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | 5-(1,3-dioxolan-2-yl)-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 68968036 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-1,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC1=C2CCCC(C3OCCO3)C2(C)CCC1=O |
| InChI | InChI=1S/C15H22O3/c1-10-11-4-3-5-12(14-17-8-9-18-14)15(11,2)7-6-13(10)16/h12,14H,3-9H2,1-2H3 |
| InChIKey | PGTXMNVIOWPHOQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |