C50H66N12O4 — CID 68968124
1,2-bis[3-[4-morpholin-4-yl-7-[(2-piperidin-1-ylethylamino)methyl]-5H-pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]ethane-1,2-diol (PubChem CID 68968124) has the molecular formula C50H66N12O4 and a molecular weight of 899.16 g/mol. Its IUPAC name is 1,2-bis[3-[4-morpholin-4-yl-7-[(2-piperidin-1-ylethylamino)methyl]-5H-pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]ethane-1,2-diol.
| Compound Name | 1,2-bis[3-[4-morpholin-4-yl-7-[(2-piperidin-1-ylethylamino)methyl]-5H-pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 68968124 |
| Molecular Formula | C50H66N12O4 |
| Molecular Weight | 899.16 g/mol |
| Exact Mass | 898.53 |
| IUPAC Name | 1,2-bis[3-[4-morpholin-4-yl-7-[(2-piperidin-1-ylethylamino)methyl]-5H-pyrrolo[3,2-d]pyrimidin-2-yl]phenyl]ethane-1,2-diol |
| SMILES | OC(c1cccc(-c2nc(N3CCOCC3)c3[nH]cc(CNCCN4CCCCC4)c3n2)c1)C(O)c1cccc(-c2nc(N3CCOCC3)c3[nH]cc(CNCCN4CCCCC4)c3n2)c1 |
| InChI | InChI=1S/C50H66N12O4/c63-45(35-9-7-11-37(29-35)47-55-41-39(31-51-13-19-59-15-3-1-4-16-59)33-53-43(41)49(57-47)61-21-25-65-26-22-61)46(64)36-10-8-12-38(30-36)48-56-42-40(32-52-14-20-60-17-5-2-6-18-60)34-54-44(42)50(58-48)62-23-27-66-28-24-62/h7-12,29-30,33-34,45-46,51-54,63-64H,1-6,13-28,31-32H2 |
| InChIKey | DZXANSDLUBHRKN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 179.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 66 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.16 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|