C20H25N3O5 — CID 68968377
1-[3-methoxy-4-(2-methyl-4-nitrophenoxy)phenyl]-3-pentan-3-ylurea (PubChem CID 68968377) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[3-methoxy-4-(2-methyl-4-nitrophenoxy)phenyl]-3-pentan-3-ylurea.
| Compound Name | 1-[3-methoxy-4-(2-methyl-4-nitrophenoxy)phenyl]-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 68968377 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-[3-methoxy-4-(2-methyl-4-nitrophenoxy)phenyl]-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)Nc1ccc(Oc2ccc([N+](=O)[O-])cc2C)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O5/c1-5-14(6-2)21-20(24)22-15-7-9-18(19(12-15)27-4)28-17-10-8-16(23(25)26)11-13(17)3/h7-12,14H,5-6H2,1-4H3,(H2,21,22,24) |
| InChIKey | ZNIKWLYDFUWYKP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|