C19H22ClFO2 — CID 68968562
(3Z,4aS,5S)-3-[(2-chloro-6-fluorophenyl)methylidene]-5-hydroxy-1,4a-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one (PubChem CID 68968562) has the molecular formula C19H22ClFO2 and a molecular weight of 336.83 g/mol. Its IUPAC name is (3Z,4aS,5S)-3-[(2-chloro-6-fluorophenyl)methylidene]-5-hydroxy-1,4a-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one.
| Compound Name | (3Z,4aS,5S)-3-[(2-chloro-6-fluorophenyl)methylidene]-5-hydroxy-1,4a-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 68968562 |
| Molecular Formula | C19H22ClFO2 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (3Z,4aS,5S)-3-[(2-chloro-6-fluorophenyl)methylidene]-5-hydroxy-1,4a-dimethyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-one |
| SMILES | CC1C(=O)/C(=C\c2c(F)cccc2Cl)C[C@@]2(C)C1CCC[C@@H]2O |
| InChI | InChI=1S/C19H22ClFO2/c1-11-14-5-3-8-17(22)19(14,2)10-12(18(11)23)9-13-15(20)6-4-7-16(13)21/h4,6-7,9,11,14,17,22H,3,5,8,10H2,1-2H3/b12-9-/t11?,14?,17-,19-/m0/s1 |
| InChIKey | ADHQXEZUCXJMIV-JTQZZCMQSA-N |
| XLogP | 4.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|