C26H23FO2 — CID 68968745
(3E,4aS,5S)-3-[[4-[2-(3-fluorophenyl)ethynyl]phenyl]methylidene]-5-hydroxy-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68968745) has the molecular formula C26H23FO2 and a molecular weight of 386.47 g/mol. Its IUPAC name is (3E,4aS,5S)-3-[[4-[2-(3-fluorophenyl)ethynyl]phenyl]methylidene]-5-hydroxy-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4aS,5S)-3-[[4-[2-(3-fluorophenyl)ethynyl]phenyl]methylidene]-5-hydroxy-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68968745 |
| Molecular Formula | C26H23FO2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (3E,4aS,5S)-3-[[4-[2-(3-fluorophenyl)ethynyl]phenyl]methylidene]-5-hydroxy-4a-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | C[C@]12C/C(=C\c3ccc(C#Cc4cccc(F)c4)cc3)C(=O)C=C1CCC[C@@H]2O |
| InChI | InChI=1S/C26H23FO2/c1-26-17-21(24(28)16-22(26)5-3-7-25(26)29)14-20-12-9-18(10-13-20)8-11-19-4-2-6-23(27)15-19/h2,4,6,9-10,12-16,25,29H,3,5,7,17H2,1H3/b21-14+/t25-,26-/m0/s1 |
| InChIKey | FUPUBGKJZBDABJ-WWNTWXPRSA-N |
| XLogP | 5.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|