C20H15ClF3N5O — CID 68969149
N-(diaminomethylidene)-1-[6-(trifluoromethyl)quinolin-4-yl]indole-3-carboxamide;hydrochloride (PubChem CID 68969149) has the molecular formula C20H15ClF3N5O and a molecular weight of 433.82 g/mol. Its IUPAC name is N-(diaminomethylidene)-1-[6-(trifluoromethyl)quinolin-4-yl]indole-3-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-1-[6-(trifluoromethyl)quinolin-4-yl]indole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68969149 |
| Molecular Formula | C20H15ClF3N5O |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-(diaminomethylidene)-1-[6-(trifluoromethyl)quinolin-4-yl]indole-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1cn(-c2ccnc3ccc(C(F)(F)F)cc23)c2ccccc12 |
| InChI | InChI=1S/C20H14F3N5O.ClH/c21-20(22,23)11-5-6-15-13(9-11)17(7-8-26-15)28-10-14(18(29)27-19(24)25)12-3-1-2-4-16(12)28;/h1-10H,(H4,24,25,27,29);1H |
| InChIKey | OJOFZGZBZVWVOS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|