C20H24O2S — CID 68969331
(3E,4R,4aS,5S)-5-hydroxy-4,4a-dimethyl-3-[(4-methylsulfanylphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 68969331) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is (3E,4R,4aS,5S)-5-hydroxy-4,4a-dimethyl-3-[(4-methylsulfanylphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4R,4aS,5S)-5-hydroxy-4,4a-dimethyl-3-[(4-methylsulfanylphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 68969331 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3E,4R,4aS,5S)-5-hydroxy-4,4a-dimethyl-3-[(4-methylsulfanylphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CSc1ccc(/C=C2/C(=O)C=C3CCC[C@H](O)[C@@]3(C)[C@H]2C)cc1 |
| InChI | InChI=1S/C20H24O2S/c1-13-17(11-14-7-9-16(23-3)10-8-14)18(21)12-15-5-4-6-19(22)20(13,15)2/h7-13,19,22H,4-6H2,1-3H3/b17-11+/t13-,19-,20-/m0/s1 |
| InChIKey | JWIQFWTXLYPTFC-KOCPIOHSSA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|