C39H45FN10O2 — CID 68969523
1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-2-piperidin-4-yl-1,2-bis(5-pyridin-3-ylpyrimidin-2-yl)hydrazine (PubChem CID 68969523) has the molecular formula C39H45FN10O2 and a molecular weight of 704.86 g/mol. Its IUPAC name is 1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-2-piperidin-4-yl-1,2-bis(5-pyridin-3-ylpyrimidin-2-yl)hydrazine.
| Compound Name | 1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-2-piperidin-4-yl-1,2-bis(5-pyridin-3-ylpyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 68969523 |
| Molecular Formula | C39H45FN10O2 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.37 |
| IUPAC Name | 1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]-2-piperidin-4-yl-1,2-bis(5-pyridin-3-ylpyrimidin-2-yl)hydrazine |
| SMILES | CCOc1cc(CN2CCC(N(c3ncc(-c4cccnc4)cn3)N(c3ncc(-c4cccnc4)cn3)C3CCNCC3)CC2)cc(OCC)c1F |
| InChI | InChI=1S/C39H45FN10O2/c1-3-51-35-19-28(20-36(37(35)40)52-4-2)27-48-17-11-34(12-18-48)50(39-46-25-32(26-47-39)30-8-6-14-43-22-30)49(33-9-15-41-16-10-33)38-44-23-31(24-45-38)29-7-5-13-42-21-29/h5-8,13-14,19-26,33-34,41H,3-4,9-12,15-18,27H2,1-2H3 |
| InChIKey | APOQLCFFQAKEBX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 117.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|