C10H13NOS — CID 68970560
5-prop-2-enyl-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one (PubChem CID 68970560) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 5-prop-2-enyl-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one.
| Compound Name | 5-prop-2-enyl-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 68970560 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 5-prop-2-enyl-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
| SMILES | C=CCN1CCC2SC(=O)C=C2C1 |
| InChI | InChI=1S/C10H13NOS/c1-2-4-11-5-3-9-8(7-11)6-10(12)13-9/h2,6,9H,1,3-5,7H2 |
| InChIKey | VBNFZMOVLIZJCO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|