About 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide
2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide (PubChem CID 68970597) has the molecular formula C12H10F2N4O2
and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide |
| PubChem CID | 68970597 |
| Molecular Formula | C12H10F2N4O2 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide |
| SMILES | NC(=O)C(C(=O)Nc1ncc[nH]1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H10F2N4O2/c13-7-3-6(4-8(14)5-7)9(10(15)19)11(20)18-12-16-1-2-17-12/h1-5,9H,(H2,15,19)(H2,16,17,18,20) |
| InChIKey | HJLHJWWPTHVOED-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide?
The IUPAC name of 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide (CID 68970597) is 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide.
What is the SMILES notation for 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide?
The canonical SMILES for 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide is NC(=O)C(C(=O)Nc1ncc[nH]1)c1cc(F)cc(F)c1.
What is the InChIKey of 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide?
The InChIKey is HJLHJWWPTHVOED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N4O2/c13-7-3-6(4-8(14)5-7)9(10(15)19)11(20)18-12-16-1-2-17-12/h1-5,9H,(H2,15,19)(H2,16,17,18,20).
What are the key properties of 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide?
2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide has a molecular weight of 280.23 g/mol, XLogP of 0.90, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)-N'-(1H-imidazol-2-yl)propanediamide is sourced from PubChem (CID 68970597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).