C16H19ClN2O3 — CID 68971123
tert-butyl (3aR,6aS)-3-(4-chlorophenyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylate (PubChem CID 68971123) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-3-(4-chlorophenyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-3-(4-chlorophenyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylate |
|---|---|
| PubChem CID | 68971123 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | tert-butyl (3aR,6aS)-3-(4-chlorophenyl)-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C(c3ccc(Cl)cc3)=NO[C@@H]2C1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-16(2,3)21-15(20)19-8-12-13(9-19)22-18-14(12)10-4-6-11(17)7-5-10/h4-7,12-13H,8-9H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | CWYFGLHUMFEHLC-QWHCGFSZSA-N |
| XLogP | 3.31 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |