C30H36F3N3O6 — CID 68971320
2-[2-[9-[(2,2-dimethyl-1,3-benzodioxol-4-yl)methyl]-3,9-diazaspiro[5.5]undecane-3-carbonyl]phenyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 68971320) has the molecular formula C30H36F3N3O6 and a molecular weight of 591.63 g/mol. Its IUPAC name is 2-[2-[9-[(2,2-dimethyl-1,3-benzodioxol-4-yl)methyl]-3,9-diazaspiro[5.5]undecane-3-carbonyl]phenyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[9-[(2,2-dimethyl-1,3-benzodioxol-4-yl)methyl]-3,9-diazaspiro[5.5]undecane-3-carbonyl]phenyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68971320 |
| Molecular Formula | C30H36F3N3O6 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 2-[2-[9-[(2,2-dimethyl-1,3-benzodioxol-4-yl)methyl]-3,9-diazaspiro[5.5]undecane-3-carbonyl]phenyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1(C)Oc2cccc(CN3CCC4(CC3)CCN(C(=O)c3ccccc3CC(N)=O)CC4)c2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H35N3O4.C2HF3O2/c1-27(2)34-23-9-5-7-21(25(23)35-27)19-30-14-10-28(11-15-30)12-16-31(17-13-28)26(33)22-8-4-3-6-20(22)18-24(29)32;3-2(4,5)1(6)7/h3-9H,10-19H2,1-2H3,(H2,29,32);(H,6,7) |
| InChIKey | IAJSXKOJJKBDPU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |