About 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine
3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine (PubChem CID 68971549) has the molecular formula C21H18FN5O2
and a molecular weight of 391.41 g/mol. Its IUPAC name is 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine |
| PubChem CID | 68971549 |
| Molecular Formula | C21H18FN5O2 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine |
| SMILES | Nc1ccc(-c2cc(C(COc3ccccn3)c3ccccc3F)no2)c(N)n1 |
| InChI | InChI=1S/C21H18FN5O2/c22-16-6-2-1-5-13(16)15(12-28-20-7-3-4-10-25-20)17-11-18(29-27-17)14-8-9-19(23)26-21(14)24/h1-11,15H,12H2,(H4,23,24,26) |
| InChIKey | USJROEUMQVTMHW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine?
The IUPAC name of 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine (CID 68971549) is 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine.
What is the SMILES notation for 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine?
The canonical SMILES for 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine is Nc1ccc(-c2cc(C(COc3ccccn3)c3ccccc3F)no2)c(N)n1.
What is the InChIKey of 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine?
The InChIKey is USJROEUMQVTMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18FN5O2/c22-16-6-2-1-5-13(16)15(12-28-20-7-3-4-10-25-20)17-11-18(29-27-17)14-8-9-19(23)26-21(14)24/h1-11,15H,12H2,(H4,23,24,26).
What are the key properties of 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine?
3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine has a molecular weight of 391.41 g/mol, XLogP of 3.65, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[1-(2-fluorophenyl)-2-pyridin-2-yloxyethyl]-1,2-oxazol-5-yl]pyridine-2,6-diamine is sourced from PubChem (CID 68971549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).