C21H13N5O3 — CID 68972119
2-[[6-(2-pyridin-3-ylethynyl)pyridine-2-carbonyl]amino]-1H-benzimidazole-4-carboxylic acid (PubChem CID 68972119) has the molecular formula C21H13N5O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-[[6-(2-pyridin-3-ylethynyl)pyridine-2-carbonyl]amino]-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-[[6-(2-pyridin-3-ylethynyl)pyridine-2-carbonyl]amino]-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68972119 |
| Molecular Formula | C21H13N5O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-[[6-(2-pyridin-3-ylethynyl)pyridine-2-carbonyl]amino]-1H-benzimidazole-4-carboxylic acid |
| SMILES | O=C(Nc1nc2c(C(=O)O)cccc2[nH]1)c1cccc(C#Cc2cccnc2)n1 |
| InChI | InChI=1S/C21H13N5O3/c27-19(26-21-24-16-7-2-6-15(20(28)29)18(16)25-21)17-8-1-5-14(23-17)10-9-13-4-3-11-22-12-13/h1-8,11-12H,(H,28,29)(H2,24,25,26,27) |
| InChIKey | FEWKPYMFLLHPEC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|