C30H30N6 — CID 68973686
N-(1H-benzimidazol-2-ylmethyl)-N-[4-[(pyridin-4-ylmethylamino)methyl]phenyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 68973686) has the molecular formula C30H30N6 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-N-[4-[(pyridin-4-ylmethylamino)methyl]phenyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-N-[4-[(pyridin-4-ylmethylamino)methyl]phenyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 68973686 |
| Molecular Formula | C30H30N6 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-N-[4-[(pyridin-4-ylmethylamino)methyl]phenyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | c1cnc2c(c1)CCCC2N(Cc1nc2ccccc2[nH]1)c1ccc(CNCc2ccncc2)cc1 |
| InChI | InChI=1S/C30H30N6/c1-2-8-27-26(7-1)34-29(35-27)21-36(28-9-3-5-24-6-4-16-33-30(24)28)25-12-10-22(11-13-25)19-32-20-23-14-17-31-18-15-23/h1-2,4,6-8,10-18,28,32H,3,5,9,19-21H2,(H,34,35) |
| InChIKey | RNJPBLVKGWWMRS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|