C22H20N4O2 — CID 68973860
2-amino-N-[2-(4-phenoxyphenyl)ethyl]-1H-benzimidazole-4-carboxamide (PubChem CID 68973860) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-amino-N-[2-(4-phenoxyphenyl)ethyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-amino-N-[2-(4-phenoxyphenyl)ethyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 68973860 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-amino-N-[2-(4-phenoxyphenyl)ethyl]-1H-benzimidazole-4-carboxamide |
| SMILES | Nc1nc2c(C(=O)NCCc3ccc(Oc4ccccc4)cc3)cccc2[nH]1 |
| InChI | InChI=1S/C22H20N4O2/c23-22-25-19-8-4-7-18(20(19)26-22)21(27)24-14-13-15-9-11-17(12-10-15)28-16-5-2-1-3-6-16/h1-12H,13-14H2,(H,24,27)(H3,23,25,26) |
| InChIKey | KYERLJPHLVFANA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |