C17H25N3O9 — CID 68974660
1-ethyl-1,3,5-triazinane-2,4,6-trione;tris(2-methylprop-2-enoic acid) (PubChem CID 68974660) has the molecular formula C17H25N3O9 and a molecular weight of 415.40 g/mol. Its IUPAC name is 1-ethyl-1,3,5-triazinane-2,4,6-trione;tris(2-methylprop-2-enoic acid).
| Compound Name | 1-ethyl-1,3,5-triazinane-2,4,6-trione;tris(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 68974660 |
| Molecular Formula | C17H25N3O9 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-ethyl-1,3,5-triazinane-2,4,6-trione;tris(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O.CCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H7N3O3.3C4H6O2/c1-2-8-4(10)6-3(9)7-5(8)11;3*1-3(2)4(5)6/h2H2,1H3,(H2,6,7,9,10,11);3*1H2,2H3,(H,5,6) |
| InChIKey | DCPQZWQXEQMBGF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 199.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|