About ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate
ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate (PubChem CID 68974762) has the molecular formula C19H21F3N2O5
and a molecular weight of 414.38 g/mol. Its IUPAC name is ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate |
| PubChem CID | 68974762 |
| Molecular Formula | C19H21F3N2O5 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2cc(OC)cc(N3CCN(CC(F)(F)F)CC3)c2o1 |
| InChI | InChI=1S/C19H21F3N2O5/c1-3-28-18(26)16-10-15(25)13-8-12(27-2)9-14(17(13)29-16)24-6-4-23(5-7-24)11-19(20,21)22/h8-10H,3-7,11H2,1-2H3 |
| InChIKey | BDFJNIVNIVYDRI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate?
The IUPAC name of ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate (CID 68974762) is ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate.
What is the SMILES notation for ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate?
The canonical SMILES for ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate is CCOC(=O)c1cc(=O)c2cc(OC)cc(N3CCN(CC(F)(F)F)CC3)c2o1.
What is the InChIKey of ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate?
The InChIKey is BDFJNIVNIVYDRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3N2O5/c1-3-28-18(26)16-10-15(25)13-8-12(27-2)9-14(17(13)29-16)24-6-4-23(5-7-24)11-19(20,21)22/h8-10H,3-7,11H2,1-2H3.
What are the key properties of ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate?
ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate has a molecular weight of 414.38 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-methoxy-4-oxo-8-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]chromene-2-carboxylate is sourced from PubChem (CID 68974762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).