C18H22N2O2 — CID 68975555
1-(4-pyridin-2-ylphenyl)hexan-2-ylcarbamic acid (PubChem CID 68975555) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(4-pyridin-2-ylphenyl)hexan-2-ylcarbamic acid.
| Compound Name | 1-(4-pyridin-2-ylphenyl)hexan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 68975555 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(4-pyridin-2-ylphenyl)hexan-2-ylcarbamic acid |
| SMILES | CCCCC(Cc1ccc(-c2ccccn2)cc1)NC(=O)O |
| InChI | InChI=1S/C18H22N2O2/c1-2-3-6-16(20-18(21)22)13-14-8-10-15(11-9-14)17-7-4-5-12-19-17/h4-5,7-12,16,20H,2-3,6,13H2,1H3,(H,21,22) |
| InChIKey | OSPFIRFRUFWXHG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |