About 2,3-dicyclohexylphenol;4-phenylphenol
2,3-dicyclohexylphenol;4-phenylphenol (PubChem CID 68975565) has the molecular formula C30H36O2
and a molecular weight of 428.62 g/mol. Its IUPAC name is 2,3-dicyclohexylphenol;4-phenylphenol.
Molecular Properties
| Compound Name | 2,3-dicyclohexylphenol;4-phenylphenol |
| PubChem CID | 68975565 |
| Molecular Formula | C30H36O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 2,3-dicyclohexylphenol;4-phenylphenol |
| SMILES | Oc1ccc(-c2ccccc2)cc1.Oc1cccc(C2CCCCC2)c1C1CCCCC1 |
| InChI | InChI=1S/C18H26O.C12H10O/c19-17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h7,12-15,19H,1-6,8-11H2;1-9,13H |
| InChIKey | OWKYTJZHVICPMZ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dicyclohexylphenol;4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dicyclohexylphenol;4-phenylphenol?
The IUPAC name of 2,3-dicyclohexylphenol;4-phenylphenol (CID 68975565) is 2,3-dicyclohexylphenol;4-phenylphenol.
What is the SMILES notation for 2,3-dicyclohexylphenol;4-phenylphenol?
The canonical SMILES for 2,3-dicyclohexylphenol;4-phenylphenol is Oc1ccc(-c2ccccc2)cc1.Oc1cccc(C2CCCCC2)c1C1CCCCC1.
What is the InChIKey of 2,3-dicyclohexylphenol;4-phenylphenol?
The InChIKey is OWKYTJZHVICPMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O.C12H10O/c19-17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h7,12-15,19H,1-6,8-11H2;1-9,13H.
What are the key properties of 2,3-dicyclohexylphenol;4-phenylphenol?
2,3-dicyclohexylphenol;4-phenylphenol has a molecular weight of 428.62 g/mol, XLogP of 8.55, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dicyclohexylphenol;4-phenylphenol is sourced from PubChem (CID 68975565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).