About [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride
[(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride (PubChem CID 68975638) has the molecular formula C11H20ClN
and a molecular weight of 201.74 g/mol. Its IUPAC name is [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride.
Molecular Properties
| Compound Name | [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride |
| PubChem CID | 68975638 |
| Molecular Formula | C11H20ClN |
| Molecular Weight | 201.74 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride |
| SMILES | CC[C@@]1([N+](C)(C)C)C=CC=CC1.[Cl-] |
| InChI | InChI=1S/C11H20N.ClH/c1-5-11(12(2,3)4)9-7-6-8-10-11;/h6-9H,5,10H2,1-4H3;1H/q+1;/p-1/t11-;/m1./s1 |
| InChIKey | FSXWJBFXWJEHAA-RFVHGSKJSA-M |
| XLogP | -0.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.74 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride?
The IUPAC name of [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride (CID 68975638) is [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride.
What is the SMILES notation for [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride?
The canonical SMILES for [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride is CC[C@@]1([N+](C)(C)C)C=CC=CC1.[Cl-].
What is the InChIKey of [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride?
The InChIKey is FSXWJBFXWJEHAA-RFVHGSKJSA-M. The full InChI is InChI=1S/C11H20N.ClH/c1-5-11(12(2,3)4)9-7-6-8-10-11;/h6-9H,5,10H2,1-4H3;1H/q+1;/p-1/t11-;/m1./s1.
What are the key properties of [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride?
[(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride has a molecular weight of 201.74 g/mol, XLogP of -0.64, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-ethylcyclohexa-2,4-dien-1-yl]-trimethylazanium chloride is sourced from PubChem (CID 68975638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).