C26H32FNO2 — CID 68975826
(8S,9S,10R,13S,14S,17S)-N-(3-fluorophenyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 68975826) has the molecular formula C26H32FNO2 and a molecular weight of 409.55 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-N-(3-fluorophenyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (8S,9S,10R,13S,14S,17S)-N-(3-fluorophenyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 68975826 |
| Molecular Formula | C26H32FNO2 |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-N-(3-fluorophenyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C26H32FNO2/c1-25-12-10-19(29)14-16(25)6-7-20-21-8-9-23(26(21,2)13-11-22(20)25)24(30)28-18-5-3-4-17(27)15-18/h3-5,14-15,20-23H,6-13H2,1-2H3,(H,28,30)/t20-,21-,22-,23+,25-,26-/m0/s1 |
| InChIKey | ZLJPNQRPJHWILA-PDVSWFIFSA-N |
| XLogP | 5.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |