C14H22N4 — CID 68976138
1-(1-methyl-2,3-dihydropyrrol-5-yl)-N-[2-[(1-methyl-2,3-dihydropyrrol-5-yl)methylideneamino]ethyl]methanimine (PubChem CID 68976138) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1-(1-methyl-2,3-dihydropyrrol-5-yl)-N-[2-[(1-methyl-2,3-dihydropyrrol-5-yl)methylideneamino]ethyl]methanimine.
| Compound Name | 1-(1-methyl-2,3-dihydropyrrol-5-yl)-N-[2-[(1-methyl-2,3-dihydropyrrol-5-yl)methylideneamino]ethyl]methanimine |
|---|---|
| PubChem CID | 68976138 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-(1-methyl-2,3-dihydropyrrol-5-yl)-N-[2-[(1-methyl-2,3-dihydropyrrol-5-yl)methylideneamino]ethyl]methanimine |
| SMILES | CN1CCC=C1/C=N/CC/N=C/C1=CCCN1C |
| InChI | InChI=1S/C14H22N4/c1-17-9-3-5-13(17)11-15-7-8-16-12-14-6-4-10-18(14)2/h5-6,11-12H,3-4,7-10H2,1-2H3/b15-11+,16-12+ |
| InChIKey | PRNIRTBLZYNVON-JOBJLJCHSA-N |
| XLogP | 1.57 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|