C8H16N2 — CID 68976248
(3R,4R)-N-cyclopropyl-4-methylpyrrolidin-3-amine (PubChem CID 68976248) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (3R,4R)-N-cyclopropyl-4-methylpyrrolidin-3-amine.
| Compound Name | (3R,4R)-N-cyclopropyl-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 68976248 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (3R,4R)-N-cyclopropyl-4-methylpyrrolidin-3-amine |
| SMILES | C[C@@H]1CNC[C@@H]1NC1CC1 |
| InChI | InChI=1S/C8H16N2/c1-6-4-9-5-8(6)10-7-2-3-7/h6-10H,2-5H2,1H3/t6-,8+/m1/s1 |
| InChIKey | AWBQLJZFNKZKTE-SVRRBLITSA-N |
| XLogP | 0.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |