About 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one
3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one (PubChem CID 68977069) has the molecular formula C15H10O5
and a molecular weight of 270.24 g/mol. Its IUPAC name is 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one.
Molecular Properties
| Compound Name | 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one |
| PubChem CID | 68977069 |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one |
| SMILES | O=C1Oc2ccc(O)cc2C1=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H10O5/c16-9-2-4-14-10(7-9)11(15(19)20-14)5-8-1-3-12(17)13(18)6-8/h1-7,16-18H |
| InChIKey | BOWHITWXJNIGIM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one?
The IUPAC name of 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one (CID 68977069) is 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one.
What is the SMILES notation for 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one?
The canonical SMILES for 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one is O=C1Oc2ccc(O)cc2C1=Cc1ccc(O)c(O)c1.
What is the InChIKey of 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one?
The InChIKey is BOWHITWXJNIGIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O5/c16-9-2-4-14-10(7-9)11(15(19)20-14)5-8-1-3-12(17)13(18)6-8/h1-7,16-18H.
What are the key properties of 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one?
3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one has a molecular weight of 270.24 g/mol, XLogP of 2.26, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dihydroxyphenyl)methylidene]-5-hydroxy-1-benzofuran-2-one is sourced from PubChem (CID 68977069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).