About 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one
5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 68977445) has the molecular formula C23H18N2O3
and a molecular weight of 370.41 g/mol. Its IUPAC name is 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one |
| PubChem CID | 68977445 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | O=c1cc(-c2ccc(C=Cc3ccc(O)c(O)c3)cc2)[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C23H18N2O3/c26-21-13-10-17(14-22(21)27)7-6-16-8-11-18(12-9-16)20-15-23(28)25(24-20)19-4-2-1-3-5-19/h1-15,24,26-27H |
| InChIKey | ZIRWUGZFDLVJSF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one?
The IUPAC name of 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one (CID 68977445) is 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one.
What is the SMILES notation for 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one?
The canonical SMILES for 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one is O=c1cc(-c2ccc(C=Cc3ccc(O)c(O)c3)cc2)[nH]n1-c1ccccc1.
What is the InChIKey of 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one?
The InChIKey is ZIRWUGZFDLVJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O3/c26-21-13-10-17(14-22(21)27)7-6-16-8-11-18(12-9-16)20-15-23(28)25(24-20)19-4-2-1-3-5-19/h1-15,24,26-27H.
What are the key properties of 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one?
5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one has a molecular weight of 370.41 g/mol, XLogP of 4.41, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[2-(3,4-dihydroxyphenyl)ethenyl]phenyl]-2-phenyl-1H-pyrazol-3-one is sourced from PubChem (CID 68977445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).