C30H29F3N4O4 — CID 68977736
2-[3-[2-(4-phenylphenyl)ethylamino]propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 68977736) has the molecular formula C30H29F3N4O4 and a molecular weight of 566.58 g/mol. Its IUPAC name is 2-[3-[2-(4-phenylphenyl)ethylamino]propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-[2-(4-phenylphenyl)ethylamino]propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68977736 |
| Molecular Formula | C30H29F3N4O4 |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 2-[3-[2-(4-phenylphenyl)ethylamino]propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1c2c(nn1CCCNCCc1ccc(-c3ccccc3)cc1)-c1ccncc1CC2 |
| InChI | InChI=1S/C28H28N4O2.C2HF3O2/c33-28(34)27-25-12-11-23-19-30-17-14-24(23)26(25)31-32(27)18-4-15-29-16-13-20-7-9-22(10-8-20)21-5-2-1-3-6-21;3-2(4,5)1(6)7/h1-3,5-10,14,17,19,29H,4,11-13,15-16,18H2,(H,33,34);(H,6,7) |
| InChIKey | RAQBBGQWGVSTQB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|