C19H23N5O — CID 68977912
1-[2-[(5,6-dimethyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethylamino]propan-2-one (PubChem CID 68977912) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-[2-[(5,6-dimethyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethylamino]propan-2-one.
| Compound Name | 1-[2-[(5,6-dimethyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethylamino]propan-2-one |
|---|---|
| PubChem CID | 68977912 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-[2-[(5,6-dimethyl-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethylamino]propan-2-one |
| SMILES | CC(=O)CNCCNc1nc(-c2ccccc2)nc2[nH]c(C)c(C)c12 |
| InChI | InChI=1S/C19H23N5O/c1-12(25)11-20-9-10-21-18-16-13(2)14(3)22-19(16)24-17(23-18)15-7-5-4-6-8-15/h4-8,20H,9-11H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | UUMIHDISNDWIHE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|