C21H22FIN4O5S — CID 68977976
2-(2-fluoro-4-iodoanilino)-3-[3-hydroxy-3-(nitromethyl)azetidine-1-carbonyl]-5,5-dimethyl-6,7-dihydro-4H-thieno[2,3-c]azepin-8-one (PubChem CID 68977976) has the molecular formula C21H22FIN4O5S and a molecular weight of 588.40 g/mol. Its IUPAC name is 2-(2-fluoro-4-iodoanilino)-3-[3-hydroxy-3-(nitromethyl)azetidine-1-carbonyl]-5,5-dimethyl-6,7-dihydro-4H-thieno[2,3-c]azepin-8-one.
| Compound Name | 2-(2-fluoro-4-iodoanilino)-3-[3-hydroxy-3-(nitromethyl)azetidine-1-carbonyl]-5,5-dimethyl-6,7-dihydro-4H-thieno[2,3-c]azepin-8-one |
|---|---|
| PubChem CID | 68977976 |
| Molecular Formula | C21H22FIN4O5S |
| Molecular Weight | 588.40 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | 2-(2-fluoro-4-iodoanilino)-3-[3-hydroxy-3-(nitromethyl)azetidine-1-carbonyl]-5,5-dimethyl-6,7-dihydro-4H-thieno[2,3-c]azepin-8-one |
| SMILES | CC1(C)CNC(=O)c2sc(Nc3ccc(I)cc3F)c(C(=O)N3CC(O)(C[N+](=O)[O-])C3)c2C1 |
| InChI | InChI=1S/C21H22FIN4O5S/c1-20(2)6-12-15(19(29)26-8-21(30,9-26)10-27(31)32)18(33-16(12)17(28)24-7-20)25-14-4-3-11(23)5-13(14)22/h3-5,25,30H,6-10H2,1-2H3,(H,24,28) |
| InChIKey | GOQBNAWHLMOMKF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|