C62H72N4 — CID 68978180
5,10,15-tris(3,5-ditert-butylphenyl)porphyrin (PubChem CID 68978180) has the molecular formula C62H72N4 and a molecular weight of 873.29 g/mol. Its IUPAC name is 5,10,15-tris(3,5-ditert-butylphenyl)porphyrin.
| Compound Name | 5,10,15-tris(3,5-ditert-butylphenyl)porphyrin |
|---|---|
| PubChem CID | 68978180 |
| Molecular Formula | C62H72N4 |
| Molecular Weight | 873.29 g/mol |
| Exact Mass | 872.58 |
| IUPAC Name | 5,10,15-tris(3,5-ditert-butylphenyl)porphyrin |
| SMILES | CC(C)(C)c1cc(/C2=C3\C=CC(=N3)/C=C3/C=CC(=N3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C3/C=CC(=N3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C3/C=CC2=N3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C62H72N4/c1-57(2,3)40-27-37(28-41(33-40)58(4,5)6)54-48-21-19-46(63-48)36-47-20-22-49(64-47)55(38-29-42(59(7,8)9)34-43(30-38)60(10,11)12)51-24-26-53(66-51)56(52-25-23-50(54)65-52)39-31-44(61(13,14)15)35-45(32-39)62(16,17)18/h19-36H,1-18H3/b46-36-,47-36-,54-48-,54-50-,55-49-,55-51-,56-52-,56-53- |
| InChIKey | XPPIGVXATJQLHJ-JPWVWUTESA-N |
| XLogP | 15.95 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.29 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |