C21H23Cl2N5O2S — CID 68978823
N-[(2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclopentyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;hydrochloride (PubChem CID 68978823) has the molecular formula C21H23Cl2N5O2S and a molecular weight of 480.42 g/mol. Its IUPAC name is N-[(2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclopentyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;hydrochloride.
| Compound Name | N-[(2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclopentyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68978823 |
| Molecular Formula | C21H23Cl2N5O2S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | N-[(2R)-2-[(5-chloro-1H-indole-2-carbonyl)amino]cyclopentyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(N[C@@H]1CCCC1NC(=O)c1nc2c(s1)CNCC2)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C21H22ClN5O2S.ClH/c22-12-4-5-13-11(8-12)9-17(24-13)19(28)25-14-2-1-3-15(14)26-20(29)21-27-16-6-7-23-10-18(16)30-21;/h4-5,8-9,14-15,23-24H,1-3,6-7,10H2,(H,25,28)(H,26,29);1H/t14-,15?;/m1./s1 |
| InChIKey | QSKMBNJTSNGRKJ-FUISWZMFSA-N |
| XLogP | 3.43 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |