About N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine
N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine (PubChem CID 68978835) has the molecular formula C19H38N2
and a molecular weight of 294.53 g/mol. Its IUPAC name is N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine |
| PubChem CID | 68978835 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine |
| SMILES | CCCCCCCCCNCCNC12CCC(CC1)CC2 |
| InChI | InChI=1S/C19H38N2/c1-2-3-4-5-6-7-8-15-20-16-17-21-19-12-9-18(10-13-19)11-14-19/h18,20-21H,2-17H2,1H3 |
| InChIKey | NIDKSLVFXWWRBJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine?
The IUPAC name of N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine (CID 68978835) is N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine.
What is the SMILES notation for N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine?
The canonical SMILES for N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine is CCCCCCCCCNCCNC12CCC(CC1)CC2.
What is the InChIKey of N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine?
The InChIKey is NIDKSLVFXWWRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38N2/c1-2-3-4-5-6-7-8-15-20-16-17-21-19-12-9-18(10-13-19)11-14-19/h18,20-21H,2-17H2,1H3.
What are the key properties of N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine?
N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine has a molecular weight of 294.53 g/mol, XLogP of 4.64, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-bicyclo[2.2.2]octanyl)-N-nonylethane-1,2-diamine is sourced from PubChem (CID 68978835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).