C13H12ClN5 — CID 68979283
3-chloro-5-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline (PubChem CID 68979283) has the molecular formula C13H12ClN5 and a molecular weight of 273.73 g/mol. Its IUPAC name is 3-chloro-5-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline.
| Compound Name | 3-chloro-5-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline |
|---|---|
| PubChem CID | 68979283 |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-chloro-5-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline |
| SMILES | CCc1cc(-c2cc(N)cc(Cl)c2)n2ncnc2n1 |
| InChI | InChI=1S/C13H12ClN5/c1-2-11-6-12(19-13(18-11)16-7-17-19)8-3-9(14)5-10(15)4-8/h3-7H,2,15H2,1H3 |
| InChIKey | PTYOYKAKAGYPCD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|