C25H36O6S — CID 68979814
ethyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate (PubChem CID 68979814) has the molecular formula C25H36O6S and a molecular weight of 464.62 g/mol. Its IUPAC name is ethyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate.
| Compound Name | ethyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 68979814 |
| Molecular Formula | C25H36O6S |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | ethyl 4-[2-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
| SMILES | CCOC(=O)CCCSCC[C@H]1C(=O)C[C@@H](O)[C@H]1/C=C/[C@@H](O)Cc1cccc(COC)c1 |
| InChI | InChI=1S/C25H36O6S/c1-3-31-25(29)8-5-12-32-13-11-22-21(23(27)16-24(22)28)10-9-20(26)15-18-6-4-7-19(14-18)17-30-2/h4,6-7,9-10,14,20-23,26-27H,3,5,8,11-13,15-17H2,1-2H3/b10-9+/t20-,21+,22-,23-/m1/s1 |
| InChIKey | FOVWBLLHFNVPRX-FPDSUONTSA-N |
| XLogP | 3.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|