C25H25F3N4O4 — CID 68980206
2-[3-(2,3-dihydro-1H-inden-2-ylamino)propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 68980206) has the molecular formula C25H25F3N4O4 and a molecular weight of 502.49 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1H-inden-2-ylamino)propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-(2,3-dihydro-1H-inden-2-ylamino)propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68980206 |
| Molecular Formula | C25H25F3N4O4 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 2-[3-(2,3-dihydro-1H-inden-2-ylamino)propyl]-4,5-dihydropyrazolo[3,4-f]isoquinoline-3-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1c2c(nn1CCCNC1Cc3ccccc3C1)-c1ccncc1CC2 |
| InChI | InChI=1S/C23H24N4O2.C2HF3O2/c28-23(29)22-20-7-6-17-14-24-10-8-19(17)21(20)26-27(22)11-3-9-25-18-12-15-4-1-2-5-16(15)13-18;3-2(4,5)1(6)7/h1-2,4-5,8,10,14,18,25H,3,6-7,9,11-13H2,(H,28,29);(H,6,7) |
| InChIKey | XLCRTVXFVWSXEE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|