About [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate
[5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate (PubChem CID 68980566) has the molecular formula C26H40O4
and a molecular weight of 416.60 g/mol. Its IUPAC name is [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate.
Molecular Properties
| Compound Name | [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate |
| PubChem CID | 68980566 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate |
| SMILES | CCCCCCC(C)(C)C1(OC(C)=O)C=CC(C2C=CCCCC2)=C(OC(C)=O)C1 |
| InChI | InChI=1S/C26H40O4/c1-6-7-8-13-17-25(4,5)26(30-21(3)28)18-16-23(24(19-26)29-20(2)27)22-14-11-9-10-12-15-22/h11,14,16,18,22H,6-10,12-13,15,17,19H2,1-5H3 |
| InChIKey | RWLKPZCSWNWJED-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate?
The IUPAC name of [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate (CID 68980566) is [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate.
What is the SMILES notation for [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate?
The canonical SMILES for [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate is CCCCCCC(C)(C)C1(OC(C)=O)C=CC(C2C=CCCCC2)=C(OC(C)=O)C1.
What is the InChIKey of [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate?
The InChIKey is RWLKPZCSWNWJED-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40O4/c1-6-7-8-13-17-25(4,5)26(30-21(3)28)18-16-23(24(19-26)29-20(2)27)22-14-11-9-10-12-15-22/h11,14,16,18,22H,6-10,12-13,15,17,19H2,1-5H3.
What are the key properties of [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate?
[5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate has a molecular weight of 416.60 g/mol, XLogP of 6.81, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-acetyloxy-2-cyclohept-2-en-1-yl-5-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-yl] acetate is sourced from PubChem (CID 68980566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).