C23H30O5 — CID 68980755
4-[[3-(2-methylhexan-2-yl)-5a,6,7,8,9,9a-hexahydrodibenzofuran-1-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 68980755) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 4-[[3-(2-methylhexan-2-yl)-5a,6,7,8,9,9a-hexahydrodibenzofuran-1-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[3-(2-methylhexan-2-yl)-5a,6,7,8,9,9a-hexahydrodibenzofuran-1-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 68980755 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-[[3-(2-methylhexan-2-yl)-5a,6,7,8,9,9a-hexahydrodibenzofuran-1-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | CCCCC(C)(C)c1cc(OC(=O)C=CC(=O)O)c2c(c1)OC1CCCCC21 |
| InChI | InChI=1S/C23H30O5/c1-4-5-12-23(2,3)15-13-18-22(16-8-6-7-9-17(16)27-18)19(14-15)28-21(26)11-10-20(24)25/h10-11,13-14,16-17H,4-9,12H2,1-3H3,(H,24,25) |
| InChIKey | HKZXVDVDTKKQQU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|