C34H32N2O6 — CID 68980765
(E)-3-[4-[2-[[4-(3,4-diethoxyphenyl)-4-oxobutanoyl]amino]-6-phenyl-4-pyridinyl]phenyl]prop-2-enoic acid (PubChem CID 68980765) has the molecular formula C34H32N2O6 and a molecular weight of 564.64 g/mol. Its IUPAC name is (E)-3-[4-[2-[[4-(3,4-diethoxyphenyl)-4-oxobutanoyl]amino]-6-phenyl-4-pyridinyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[[4-(3,4-diethoxyphenyl)-4-oxobutanoyl]amino]-6-phenyl-4-pyridinyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68980765 |
| Molecular Formula | C34H32N2O6 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | (E)-3-[4-[2-[[4-(3,4-diethoxyphenyl)-4-oxobutanoyl]amino]-6-phenyl-4-pyridinyl]phenyl]prop-2-enoic acid |
| SMILES | CCOc1ccc(C(=O)CCC(=O)Nc2cc(-c3ccc(/C=C/C(=O)O)cc3)cc(-c3ccccc3)n2)cc1OCC |
| InChI | InChI=1S/C34H32N2O6/c1-3-41-30-17-15-26(21-31(30)42-4-2)29(37)16-18-33(38)36-32-22-27(20-28(35-32)25-8-6-5-7-9-25)24-13-10-23(11-14-24)12-19-34(39)40/h5-15,17,19-22H,3-4,16,18H2,1-2H3,(H,39,40)(H,35,36,38)/b19-12+ |
| InChIKey | MWNOENSUSADCOW-XDHOZWIPSA-N |
| XLogP | 6.91 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|