About (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate
(3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate (PubChem CID 68980911) has the molecular formula C21H22FN3O4
and a molecular weight of 399.42 g/mol. Its IUPAC name is (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate |
| PubChem CID | 68980911 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(F)c1)ON1CCC2(CC1)CN(Cc1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C21H22FN3O4/c22-17-7-4-8-18(13-17)23-19(26)29-25-11-9-21(10-12-25)15-24(20(27)28-21)14-16-5-2-1-3-6-16/h1-8,13H,9-12,14-15H2,(H,23,26) |
| InChIKey | OGGYSTOASJTKLB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate?
The IUPAC name of (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate (CID 68980911) is (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate.
What is the SMILES notation for (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate?
The canonical SMILES for (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate is O=C(Nc1cccc(F)c1)ON1CCC2(CC1)CN(Cc1ccccc1)C(=O)O2.
What is the InChIKey of (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate?
The InChIKey is OGGYSTOASJTKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O4/c22-17-7-4-8-18(13-17)23-19(26)29-25-11-9-21(10-12-25)15-24(20(27)28-21)14-16-5-2-1-3-6-16/h1-8,13H,9-12,14-15H2,(H,23,26).
What are the key properties of (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate?
(3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate has a molecular weight of 399.42 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl) N-(3-fluorophenyl)carbamate is sourced from PubChem (CID 68980911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).