C34H61NO11Si3 — CID 68981255
methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[2-(1,3-dioxolan-2-yl)-4-nitrophenoxy]oxane-2-carboxylate (PubChem CID 68981255) has the molecular formula C34H61NO11Si3 and a molecular weight of 744.12 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[2-(1,3-dioxolan-2-yl)-4-nitrophenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[2-(1,3-dioxolan-2-yl)-4-nitrophenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 68981255 |
| Molecular Formula | C34H61NO11Si3 |
| Molecular Weight | 744.12 g/mol |
| Exact Mass | 743.36 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[2-(1,3-dioxolan-2-yl)-4-nitrophenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc([N+](=O)[O-])cc2C2OCCO2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H61NO11Si3/c1-32(2,3)47(11,12)44-25-26(45-48(13,14)33(4,5)6)28(46-49(15,16)34(7,8)9)31(43-27(25)29(36)39-10)42-24-18-17-22(35(37)38)21-23(24)30-40-19-20-41-30/h17-18,21,25-28,30-31H,19-20H2,1-16H3/t25-,26+,27+,28-,31-/m1/s1 |
| InChIKey | MZNJXSQISDGIIR-ITKRTVBJSA-N |
| XLogP | 8.09 |
| TPSA | 134.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.12 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|